Inorganic Salts
Filtered Search Results
| Molecular Weight (g/mol) | 189.71 |
|---|---|
| Color | Orange |
| Physical Form | Liquid |
| Chemical Name or Material | Titanium(IV) chloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| Merck Index | 15, 9634 |
| InChI Key | XJDNKRIXUMDJCW-UHFFFAOYSA-J |
| Density | 0.9640g/mL |
| PubChem CID | 160960 |
| Name Note | 1M Solution in Toluene |
| Concentration or Composition (by Analyte or Components) | 0.95 to 1.1M |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. IF IN EYES: Rinse cautiously with water for seve |
| MDL Number | MFCD00011267 |
| Health Hazard 2 | GHS H Statement Highly flammable liquid and vapor. Toxic if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. Suspected of damaging the unborn child. May cause drowsiness or dizziness |
| Solubility Information | Solubility in water: reacts |
| Flash Point | 8°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | titanium iv chloride,titanium 4+ tetrachloride,acmc-1bjgv,titanium 4+ ion tetrachloride,parent,titanium +4 cation tetrachloride,titanium iv chloride 100ml,superlist names titanium chloride, t-4,titanic chloride; titanio tetracloruro di,unii-8o3pje5t7q; titanium chloride ticl4 |
| IUPAC Name | titanium(4+);tetrachloride |
| Molecular Formula | Cl4Ti |
| EINECS Number | 231-441-9 |
| Formula Weight | 189.71 |
| Specific Gravity | 0.964 |
Thermo Scientific Chemicals Ethylmercurithiosalicylic acid, sodium salt, 97.0-101.0%
CAS: 54-64-8 Molecular Formula: C9H9HgNaO2S Molecular Weight (g/mol): 404.81 MDL Number: MFCD00013062 InChI Key: RTKIYNMVFMVABJ-UHFFFAOYSA-L Synonym: thimerosal,thiomersal,thiomersalate,mercurothiolate,sodium merthiolate,sodium ethylmercurithiosalicylate,merthiolate,thimerosalate,thimerosalum,thimersalate PubChem CID: 16684434 ChEBI: CHEBI:9546 IUPAC Name: sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury SMILES: [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O
| PubChem CID | 16684434 |
|---|---|
| CAS | 54-64-8 |
| Molecular Weight (g/mol) | 404.81 |
| ChEBI | CHEBI:9546 |
| MDL Number | MFCD00013062 |
| SMILES | [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O |
| Synonym | thimerosal,thiomersal,thiomersalate,mercurothiolate,sodium merthiolate,sodium ethylmercurithiosalicylate,merthiolate,thimerosalate,thimerosalum,thimersalate |
| IUPAC Name | sodium;(2-carboxylatophenyl)sulfanyl-ethylmercury |
| InChI Key | RTKIYNMVFMVABJ-UHFFFAOYSA-L |
| Molecular Formula | C9H9HgNaO2S |
Zirconium(IV) oxide, 99.7% (metals basis excluding Hf), Hf <75ppm, Thermo Scientific Chemicals
CAS: 1314-23-4 Molecular Formula: O2Zr Molecular Weight (g/mol): 123.22 MDL Number: MFCD00011310 MFCD01868884 InChI Key: MCMNRKCIXSYSNV-UHFFFAOYSA-N Synonym: zirconia,zirconium oxide,zirconium oxide zro2,rhuligel,zirconium iv oxide,zirconium white,zirconic anhydride,pigment white 12,zirox zt 35,pcs filler PubChem CID: 62395 IUPAC Name: dioxozirconium SMILES: O=[Zr]=O
| PubChem CID | 62395 |
|---|---|
| CAS | 1314-23-4 |
| Molecular Weight (g/mol) | 123.22 |
| MDL Number | MFCD00011310 MFCD01868884 |
| SMILES | O=[Zr]=O |
| Synonym | zirconia,zirconium oxide,zirconium oxide zro2,rhuligel,zirconium iv oxide,zirconium white,zirconic anhydride,pigment white 12,zirox zt 35,pcs filler |
| IUPAC Name | dioxozirconium |
| InChI Key | MCMNRKCIXSYSNV-UHFFFAOYSA-N |
| Molecular Formula | O2Zr |
Terbium(III,IV) oxide, REacton™, 99.99% (REO)
CAS: 12037-01-3 Molecular Formula: O7Tb4 Molecular Weight (g/mol): 747.69 MDL Number: MFCD00083151 InChI Key: UWZVBPNIJCKCMC-UHFFFAOYSA-N IUPAC Name: tetraoxotetraterboxane SMILES: O=[Tb]O[Tb](=O)O[Tb](=O)O[Tb]=O
| CAS | 12037-01-3 |
|---|---|
| Molecular Weight (g/mol) | 747.69 |
| MDL Number | MFCD00083151 |
| SMILES | O=[Tb]O[Tb](=O)O[Tb](=O)O[Tb]=O |
| IUPAC Name | tetraoxotetraterboxane |
| InChI Key | UWZVBPNIJCKCMC-UHFFFAOYSA-N |
| Molecular Formula | O7Tb4 |
| Packaging | Plastic bottle |
|---|---|
| Physical Form | Liquid |
| Chemical Name or Material | Ringer's Solution |
| Synonym | dihydrogen oxide,dihydrogen monoxide |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
L-Lactic acid sodium salt, 99%, extra pure
CAS: 867-56-1 Molecular Formula: C3H5NaO3 Molecular Weight (g/mol): 112.06 Synonym: sodium l-lactate,sodium-l-lactate,sodium lactate, l,sodium s-2-hydroxypropanoate,unii-p2y1c6m9ps,sodium s-lactate,sodium l-+-lactate,p2y1c6m9ps,propanoic acid, 2-hydroxy-, monosodium salt, 2s,l-+-lactic acid sodium salt
| CAS | 867-56-1 |
|---|---|
| Molecular Weight (g/mol) | 112.06 |
| Synonym | sodium l-lactate,sodium-l-lactate,sodium lactate, l,sodium s-2-hydroxypropanoate,unii-p2y1c6m9ps,sodium s-lactate,sodium l-+-lactate,p2y1c6m9ps,propanoic acid, 2-hydroxy-, monosodium salt, 2s,l-+-lactic acid sodium salt |
| Molecular Formula | C3H5NaO3 |
Sodium tetraborate decahydrate, 99.5+%, ACS reagent
CAS: 1303-96-4 Molecular Formula: B4Na2O7·10H2O Molecular Weight (g/mol): 381.36 MDL Number: MFCD00149193 Synonym: Borax,Sodium borate decahydrate
| CAS | 1303-96-4 |
|---|---|
| Molecular Weight (g/mol) | 381.36 |
| MDL Number | MFCD00149193 |
| Synonym | Borax,Sodium borate decahydrate |
| Molecular Formula | B4Na2O7·10H2O |
Calcium nitrate tetrahydrate, 98%, extra pure
CAS: 13477-34-4 Molecular Formula: CaH8N2O10 Molecular Weight (g/mol): 236.15 InChI Key: MWGCGFYACDTFSB-UHFFFAOYSA-N Synonym: calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate PubChem CID: 16211656 ChEBI: CHEBI:86159 IUPAC Name: calcium bis(nitric acid) tetrahydrate SMILES: O.[Ca++].[O-][N+]([O-])=O
| PubChem CID | 16211656 |
|---|---|
| CAS | 13477-34-4 |
| Molecular Weight (g/mol) | 236.15 |
| ChEBI | CHEBI:86159 |
| SMILES | O.[Ca++].[O-][N+]([O-])=O |
| Synonym | calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate |
| IUPAC Name | calcium bis(nitric acid) tetrahydrate |
| InChI Key | MWGCGFYACDTFSB-UHFFFAOYSA-N |
| Molecular Formula | CaH8N2O10 |
Manganese(II) nitrate hydrate, Puratronic™, 99.995% (metals basis)
CAS: 15710-66-4 Molecular Formula: MnN2O6 Molecular Weight (g/mol): 178.95 MDL Number: MFCD00149788 InChI Key: MIVBAHRSNUNMPP-UHFFFAOYSA-N Synonym: manganese ii nitrate hydrate,acmc-1brrd,manganese nitrate hydrate,mn.2no3.h2o,manganese 2+ ion hydrate dinitrate,manganese 2+ hydrate dinitrate,manganese ii nitrate hydrate, puratronic,manganese 2+ nitrate-water 1/2/1 PubChem CID: 16211480 SMILES: [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 16211480 |
|---|---|
| CAS | 15710-66-4 |
| Molecular Weight (g/mol) | 178.95 |
| MDL Number | MFCD00149788 |
| SMILES | [Mn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | manganese ii nitrate hydrate,acmc-1brrd,manganese nitrate hydrate,mn.2no3.h2o,manganese 2+ ion hydrate dinitrate,manganese 2+ hydrate dinitrate,manganese ii nitrate hydrate, puratronic,manganese 2+ nitrate-water 1/2/1 |
| InChI Key | MIVBAHRSNUNMPP-UHFFFAOYSA-N |
| Molecular Formula | MnN2O6 |
Lithium sulfate monohydrate, ACS, 99.0% min
CAS: 10102-25-7 Molecular Formula: H2Li2O5S Molecular Weight (g/mol): 127.95 MDL Number: MFCD00149766 InChI Key: RKGLUDFWIKNKMX-UHFFFAOYSA-L Synonym: lithium sulfate monohydrate,dilithium 1+ ion hydrate sulfate,dilithium sulfate hydrate,sufuric acid, dilithium slat, monohydrate,lithiumsulfatemonohydrate,dilithotab hydrate sulfate,lithium sulphate monohydrate,lithium sulfate, acs,ksc181s7n PubChem CID: 165815 SMILES: [Li+].[Li+].O.[O-]S([O-])(=O)=O
| PubChem CID | 165815 |
|---|---|
| CAS | 10102-25-7 |
| Molecular Weight (g/mol) | 127.95 |
| MDL Number | MFCD00149766 |
| SMILES | [Li+].[Li+].O.[O-]S([O-])(=O)=O |
| Synonym | lithium sulfate monohydrate,dilithium 1+ ion hydrate sulfate,dilithium sulfate hydrate,sufuric acid, dilithium slat, monohydrate,lithiumsulfatemonohydrate,dilithotab hydrate sulfate,lithium sulphate monohydrate,lithium sulfate, acs,ksc181s7n |
| InChI Key | RKGLUDFWIKNKMX-UHFFFAOYSA-L |
| Molecular Formula | H2Li2O5S |
Sodium phosphate, tribasic dodecahydrate, extra pure
CAS: 10101-89-0 Molecular Formula: Na3O4P·12H2O Molecular Weight (g/mol): 380.13 InChI Key: ASTWEMOBIXQPPV-UHFFFAOYSA-K Synonym: trisodium phosphate dodecahydrate,sodium phosphate dodecahydrate,sodium phosphate tribasic dodecahydrate,phosphoric acid, trisodium salt, dodecahydrate,unii-b70850qphr,ccris 7322,sodium phosphate, tribasic, dodecahydrate,trisodium dodecahydrate phosphate,phosphoric acid, trisodium salt, dodeahydrate,trisodium phosphate tert dodecahydrate PubChem CID: 61473 IUPAC Name: trisodium;phosphate;dodecahydrate SMILES: O.O.O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+]
| PubChem CID | 61473 |
|---|---|
| CAS | 10101-89-0 |
| Molecular Weight (g/mol) | 380.13 |
| SMILES | O.O.O.O.O.O.O.O.O.O.O.O.[O-]P(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| Synonym | trisodium phosphate dodecahydrate,sodium phosphate dodecahydrate,sodium phosphate tribasic dodecahydrate,phosphoric acid, trisodium salt, dodecahydrate,unii-b70850qphr,ccris 7322,sodium phosphate, tribasic, dodecahydrate,trisodium dodecahydrate phosphate,phosphoric acid, trisodium salt, dodeahydrate,trisodium phosphate tert dodecahydrate |
| IUPAC Name | trisodium;phosphate;dodecahydrate |
| InChI Key | ASTWEMOBIXQPPV-UHFFFAOYSA-K |
| Molecular Formula | Na3O4P·12H2O |
Strontium chloride hexahydrate, Puratronic™, 99.9965% (metals basis)
CAS: 10025-70-4 Molecular Formula: Cl2H12O6Sr Molecular Weight (g/mol): 266.61 MDL Number: MFCD00149865 InChI Key: AMGRXJSJSONEEG-UHFFFAOYSA-L IUPAC Name: strontium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Sr++]
| CAS | 10025-70-4 |
|---|---|
| Molecular Weight (g/mol) | 266.61 |
| MDL Number | MFCD00149865 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Sr++] |
| IUPAC Name | strontium(2+) hexahydrate dichloride |
| InChI Key | AMGRXJSJSONEEG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12O6Sr |
Calcium chloride hydrate, Puratronic™, 99.9965% (metals basis)
CAS: 22691-02-7 Molecular Formula: CaCl2H12O6 Molecular Weight (g/mol): 219.068 MDL Number: MFCD00149616 InChI Key: QHFQAJHNDKBRBO-UHFFFAOYSA-L Synonym: calcium chloride hexahydrate,antarcticite,acmc-20alis,calcium hexahydrate dichloride,calcium chloride-water 1/6,calcium chloride hydrate, puratronic,calcium chloride, hydrated,calcium chloride hydrate trace metals basis 1g PubChem CID: 6093252 IUPAC Name: calcium;dichloride;hexahydrate SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Ca+2]
| PubChem CID | 6093252 |
|---|---|
| CAS | 22691-02-7 |
| Molecular Weight (g/mol) | 219.068 |
| MDL Number | MFCD00149616 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Ca+2] |
| Synonym | calcium chloride hexahydrate,antarcticite,acmc-20alis,calcium hexahydrate dichloride,calcium chloride-water 1/6,calcium chloride hydrate, puratronic,calcium chloride, hydrated,calcium chloride hydrate trace metals basis 1g |
| IUPAC Name | calcium;dichloride;hexahydrate |
| InChI Key | QHFQAJHNDKBRBO-UHFFFAOYSA-L |
| Molecular Formula | CaCl2H12O6 |
Sodium bisulfate monohydrate, 97%, extra pure, reagent, crystals
CAS: 10034-88-5 Molecular Formula: H3NaO5S Molecular Weight (g/mol): 138.07 MDL Number: MFCD00149210 InChI Key: JXHZRQHZVYDRGX-UHFFFAOYSA-M Synonym: sodium bisulfate monohydrate,sodium hydrogen sulfate monohydrate,unii-3kls9y77yj,sulfuric acid, monosodium salt, hydrate,3kls9y77yj,sodium hydrogensulfate hydrate,sulfuric acid, monosodium salt, monohydrate,sodium hydrate hydrogen sulfate,sodium hydrogen sulfate-1-hydrate,acmc-20ajox PubChem CID: 23673662 IUPAC Name: sodium;hydrogen sulfate;hydrate SMILES: O.[Na+].OS([O-])(=O)=O
| PubChem CID | 23673662 |
|---|---|
| CAS | 10034-88-5 |
| Molecular Weight (g/mol) | 138.07 |
| MDL Number | MFCD00149210 |
| SMILES | O.[Na+].OS([O-])(=O)=O |
| Synonym | sodium bisulfate monohydrate,sodium hydrogen sulfate monohydrate,unii-3kls9y77yj,sulfuric acid, monosodium salt, hydrate,3kls9y77yj,sodium hydrogensulfate hydrate,sulfuric acid, monosodium salt, monohydrate,sodium hydrate hydrogen sulfate,sodium hydrogen sulfate-1-hydrate,acmc-20ajox |
| IUPAC Name | sodium;hydrogen sulfate;hydrate |
| InChI Key | JXHZRQHZVYDRGX-UHFFFAOYSA-M |
| Molecular Formula | H3NaO5S |
Magnesium oxide, nanopowder, 99+% (metals basis)
CAS: 1309-48-4 Molecular Formula: MgO Molecular Weight (g/mol): 40.30 MDL Number: MFCD00011109 InChI Key: CPLXHLVBOLITMK-UHFFFAOYSA-N Synonym: magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag PubChem CID: 14792 IUPAC Name: oxomagnesium SMILES: O=[Mg]
| PubChem CID | 14792 |
|---|---|
| CAS | 1309-48-4 |
| Molecular Weight (g/mol) | 40.30 |
| MDL Number | MFCD00011109 |
| SMILES | O=[Mg] |
| Synonym | magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag |
| IUPAC Name | oxomagnesium |
| InChI Key | CPLXHLVBOLITMK-UHFFFAOYSA-N |
| Molecular Formula | MgO |